اسم المنتج |
2,2'-[(1-methylpropane-1,3-diyl)bis(oxy)]bis[4-methyl-1,3,2-dioxaborinane] |
الاسم بالانجليزية |
2,2'-[(1-methylpropane-1,3-diyl)bis(oxy)]bis[4-methyl-1,3,2-dioxaborinane]; 1,3,2-Dioxaborinane, 2,2'-((1-methyl-1,3-propanediyl)bis(oxy))bis(4-methyl-; 1,3-Butanediol, cyclic ester with boric acid, 1-methyltrimethylene ester; CCRIS 808; NSC 526740; 1,3-Butanediol, cyclic ester with boric acid (H3BO3), 1-methyltrimethylene ester (8CI); 2,2'-((1-Methylpropane-1,3-diyl)bis(oxy))bis(4-methyl-1,3,2-dioxaborinane); Biobor jf; 2,2'-[butane-1,3-diylbis(oxy)]bis(4-methyl-1,3,2-dioxaborinane) |
الصيغة الجزيئية |
C12H24B2O6 |
الوزن الجزيئي الغرامي |
285.9374 |
InChI |
InChI=1/C12H24B2O6/c1-10-4-7-15-13(18-10)16-8-5-11(2)19-14-17-9-6-12(3)20-14/h10-12H,4-9H2,1-3H3 |
إستراتيجية المساعدة القطرية |
2665-13-6 |
المفوضية الأوروبية رقم |
220-198-4 |
بنية جزيئية |
|
كثافة |
1.05g/cm3 |
نقطة الغليان |
279.5°C at 760 mmHg |
معامل الإنكسار |
1.433 |
نقطة الوميض |
122.8°C |
ضغط البخار |
0.0068mmHg at 25°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
|
|